EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H14O5 |
| Net Charge | 0 |
| Average Mass | 214.217 |
| Monoisotopic Mass | 214.08412 |
| SMILES | COC(=O)C1=C[C@@H](O)[C@H](OC(C)=O)CC1 |
| InChI | InChI=1S/C10H14O5/c1-6(11)15-9-4-3-7(5-8(9)12)10(13)14-2/h5,8-9,12H,3-4H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | ZEQHTIZCTRWTEP-RKDXNWHRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chaetomiumspecies (ncbitaxon:1769349) | - | DOI (10.1016/j.tet.2016.08.022) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Shikimeran A (CHEBI:202694) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| methyl (3R,4R)-4-acetyloxy-3-hydroxycyclohexene-1-carboxylate |