EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22O6 |
| Net Charge | 0 |
| Average Mass | 286.324 |
| Monoisotopic Mass | 286.14164 |
| SMILES | CCC(C)(C(=O)CC(C(=O)O)C(C)C(C)=O)C(=O)OC |
| InChI | InChI=1S/C14H22O6/c1-6-14(4,13(19)20-5)11(16)7-10(12(17)18)8(2)9(3)15/h8,10H,6-7H2,1-5H3,(H,17,18) |
| InChIKey | QIXCNKKDVZBJLN-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Curvulariaspeciescifera (ncbitaxon:145392) | - | DOI (10.1016/0031-9422(90)85006-2) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Spicifernin (CHEBI:202658) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 5-methoxycarbonyl-5-methyl-4-oxo-2-(3-oxobutan-2-yl)heptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78444022 | ChemSpider |