EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H11NO6 |
| Net Charge | 0 |
| Average Mass | 277.232 |
| Monoisotopic Mass | 277.05864 |
| SMILES | C[C@@H](C(=O)O)[C@@H]1Cc2c(cc3c(c2O)C(=O)NC3=O)O1 |
| InChI | InChI=1S/C13H11NO6/c1-4(13(18)19)7-2-5-8(20-7)3-6-9(10(5)15)12(17)14-11(6)16/h3-4,7,15H,2H2,1H3,(H,18,19)(H,14,16,17)/t4-,7+/m1/s1 |
| InChIKey | RVAJKUWZAXLXGY-FBCQKBJTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Crucibulum (ncbitaxon:68774) | - | PubMed (7622427) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Salfredin C1 (CHEBI:202634) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2R)-2-[(2S)-4-hydroxy-5,7-dioxo-2,3-dihydrouro[3,2-]isoindol-2-yl]propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 9952932 | ChemSpider |