EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H28O4 |
| Net Charge | 0 |
| Average Mass | 320.429 |
| Monoisotopic Mass | 320.19876 |
| SMILES | CC1=C[C@@H](O)[C@H]2C[C@@H](C)[C@H](O)[C@@H](C)[C@@H]2[C@H]1/C=C/C=C(\C)C(=O)O |
| InChI | InChI=1S/C19H28O4/c1-10(19(22)23)6-5-7-14-11(2)9-16(20)15-8-12(3)18(21)13(4)17(14)15/h5-7,9,12-18,20-21H,8H2,1-4H3,(H,22,23)/b7-5+,10-6+/t12-,13+,14+,15-,16-,17-,18+/m1/s1 |
| InChIKey | JHSQFDKHGZYBKL-PQJKADKUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichodermaspeciesrale (ncbitaxon:63588) | - | DOI (10.1002/hlca.201100417) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trichodermic acid B (CHEBI:202581) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| (2E,4E)-5-[(1R,4S,4aS,6R,7S,8S,8aS)-4,7-dihydroxy-2,6,8-trimethyl-1,4,4a,5,6,7,8,8a-octahydronaphthalen-1-yl]-2-methylpenta-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440895 | ChemSpider |