EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H18N2O5S2 |
| Net Charge | 0 |
| Average Mass | 406.485 |
| Monoisotopic Mass | 406.06571 |
| SMILES | O=C1N2[C@H]3C(=CC=C[C@@H]3O)C[C@]23SS[C@]12C[C@H]1[C@@H]([C@@H](O)C=C[C@@H]1O)N2C3=O |
| InChI | InChI=1S/C18H18N2O5S2/c21-10-4-5-12(23)14-9(10)7-18-16(25)19-13-8(2-1-3-11(13)22)6-17(19,26-27-18)15(24)20(14)18/h1-5,9-14,21-23H,6-7H2/t9-,10+,11+,12+,13+,14+,17-,18-/m1/s1 |
| InChIKey | QQJSAUCLZJFHSB-ZOSOKUFGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium (ncbitaxon:5073) | - | PubMed (27723361) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Brocazine G (CHEBI:202559) is a 2,5-diketopiperazines (CHEBI:65061) |
| Brocazine G (CHEBI:202559) is a indoles (CHEBI:24828) |
| Brocazine G (CHEBI:202559) is a organic disulfide (CHEBI:35489) |
| Brocazine G (CHEBI:202559) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| (1R,4S,5S,11R,14S,15S,18S,19S)-5,15,18-trihydroxy-21,22-dithia-3,13-diazahexacyclo[9.9.2.01,13.03,11.04,9.014,19]docosa-6,8,16-triene-2,12-dione |
| Manual Xrefs | Databases |
|---|---|
| 58197344 | ChemSpider |