EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H31N3O6 |
| Net Charge | 0 |
| Average Mass | 469.538 |
| Monoisotopic Mass | 469.22129 |
| SMILES | NC(CCCC(=O)N[C@@H](Cc1ccccc1)C(=O)O)CC(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C25H31N3O6/c26-19(16-23(30)28-21(25(33)34)15-18-10-5-2-6-11-18)12-7-13-22(29)27-20(24(31)32)14-17-8-3-1-4-9-17/h1-6,8-11,19-21H,7,12-16,26H2,(H,27,29)(H,28,30)(H,31,32)(H,33,34)/t19?,20-,21-/m0/s1 |
| InChIKey | YDRFWTMLXCWRLI-AKQSQHNNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonasspecies (ncbitaxon:306) | - | PubMed (11076579) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-[[5-amino-7-[[(1S)-1-carboxy-2-phenylethyl]amino]-7-oxoheptanoyl]amino]-3-phenylpropanoic acid (CHEBI:202547) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| (2S)-2-[[5-amino-7-[[(1S)-1-carboxy-2-phenylethyl]amino]-7-oxoheptanoyl]amino]-3-phenylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8942040 | ChemSpider |