EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H15N4O3 |
| Net Charge | +1 |
| Average Mass | 239.255 |
| Monoisotopic Mass | 239.11387 |
| SMILES | NC(=O)c1cc[n+](CCC[C@H](N)C(=O)O)nc1 |
| InChI | InChI=1S/C10H14N4O3/c11-8(10(16)17)2-1-4-14-5-3-7(6-13-14)9(12)15/h3,5-6,8H,1-2,4,11H2,(H2-,12,15,16,17)/p+1/t8-/m0/s1 |
| InChIKey | CMJGDZIQSOCNDZ-QMMMGPOBSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (3384747) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyridazomycin (CHEBI:202545) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-5-(4-carbamoylpyridazin-1-ium-1-yl)pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 4918606 | ChemSpider |