EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O11 |
| Net Charge | 0 |
| Average Mass | 476.434 |
| Monoisotopic Mass | 476.13186 |
| SMILES | COC(=O)C[C@@H]1O[C@@]2(O[C@@H](C)C[C@H](OC(C)=O)[C@@H]2O)C2=C(C(=O)c3cccc(O)c3C2=O)[C@@H]1O |
| InChI | InChI=1S/C23H24O11/c1-9-7-14(32-10(2)24)22(30)23(33-9)18-17(20(28)13(34-23)8-15(26)31-3)19(27)11-5-4-6-12(25)16(11)21(18)29/h4-6,9,13-14,20,22,25,28,30H,7-8H2,1-3H3/t9-,13-,14-,20+,22-,23-/m0/s1 |
| InChIKey | ZXTMPERMYSSVBM-VOVTWREWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (21934691) |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S,9S,10S,3'S,4'S,6'S)-griseusin E (CHEBI:202523) is a benzoisochromanequinone (CHEBI:48129) |
| IUPAC Name |
|---|
| methyl 2-[(1S,3S,3'S,4S,4'S,6'S)-4'-acetyloxy-3',4,9-trihydroxy-6'-methyl-5,10-dioxospiro[3,4-dihydrobenzo[g]isochromene-1,2'-oxane]-3-yl]acetate |
| Manual Xrefs | Databases |
|---|---|
| 58826671 | ChemSpider |