EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H20O4 |
| Net Charge | 0 |
| Average Mass | 240.299 |
| Monoisotopic Mass | 240.13616 |
| SMILES | CCCCC[C@H](O)[C@@H](O)c1ccc(C(C)=O)o1 |
| InChI | InChI=1S/C13H20O4/c1-3-4-5-6-10(15)13(16)12-8-7-11(17-12)9(2)14/h7-8,10,13,15-16H,3-6H2,1-2H3/t10-,13+/m0/s1 |
| InChIKey | UJDMFRZNKHOMJW-GXFFZTMASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Armillariaspecies (ncbitaxon:1906949) | - | DOI (10.1016/j.tetlet.2013.07.131) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Armillariol C (CHEBI:202509) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 1-[5-[(1R,2S)-1,2-dihydroxyheptyl]uran-2-yl]ethanone |
| Manual Xrefs | Databases |
|---|---|
| 78436881 | ChemSpider |