EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40O5 |
| Net Charge | 0 |
| Average Mass | 468.634 |
| Monoisotopic Mass | 468.28757 |
| SMILES | C=C(CCC(C)C1CC=C2C3=C(C(=O)CC21C)C1(C)CCC(=O)[C@@H](C)C1C[C@@H]3O)C(C)C(=O)O |
| InChI | InChI=1S/C29H40O5/c1-15(17(3)27(33)34)7-8-16(2)19-9-10-20-25-23(31)13-21-18(4)22(30)11-12-28(21,5)26(25)24(32)14-29(19,20)6/h10,16-19,21,23,31H,1,7-9,11-14H2,2-6H3,(H,33,34)/t16?,17?,18-,19?,21?,23-,28?,29?/m0/s1 |
| InChIKey | ZPSJWLSADLCKBZ-UGBDMSRZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Antrodia cinnamomea (ncbitaxon:279009) | - | DOI (10.1016/0031-9422(95)00541-2) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Antcin F (CHEBI:202497) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| 6-[(4S,7S)-7-hydroxy-4,10,13-trimethyl-3,11-dioxo-2,4,5,6,7,12,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methyl-3-methylideneheptanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445586 | ChemSpider |