EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H28O6 |
| Net Charge | 0 |
| Average Mass | 328.405 |
| Monoisotopic Mass | 328.18859 |
| SMILES | CCCCC[C@H]1OC(=O)[C@@H](C)C(=O)C[C@H](OC(C)=O)CC[C@@H]1O |
| InChI | InChI=1S/C17H28O6/c1-4-5-6-7-16-14(19)9-8-13(22-12(3)18)10-15(20)11(2)17(21)23-16/h11,13-14,16,19H,4-10H2,1-3H3/t11-,13+,14-,16+/m0/s1 |
| InChIKey | ULYITTZTULSLHI-ZGMNHVEMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cytosporaspecies (ncbitaxon:1715226) | - | PubMed (22011230) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cytospolide P (CHEBI:202475) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| [(3S,6R,9S,10R)-9-hydroxy-3-methyl-2,4-dioxo-10-pentyloxecan-6-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 78436877 | ChemSpider |