EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H48O3 |
| Net Charge | 0 |
| Average Mass | 444.700 |
| Monoisotopic Mass | 444.36035 |
| SMILES | [H][C@@]12CC=C3[C@]([H])(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCCC(C)C)[C@@]1(C)CC[C@H](O)[C@]2(C)C(=O)O |
| InChI | InChI=1S/C29H48O3/c1-18(2)8-7-9-19(3)21-11-12-22-20-10-13-24-28(5,23(20)14-16-27(21,22)4)17-15-25(30)29(24,6)26(31)32/h10,18-19,21-25,30H,7-9,11-17H2,1-6H3,(H,31,32)/t19-,21-,22+,23+,24-,25+,27-,28-,29-/m1/s1 |
| InChIKey | UQFZKTIHSICSPG-HBQODBAGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3β-hydroxy-4α-methyl-5α-cholest-7-ene-4β-carboxylic acid (CHEBI:20244) has parent hydride 5α-cholestane (CHEBI:35515) |
| 3β-hydroxy-4α-methyl-5α-cholest-7-ene-4β-carboxylic acid (CHEBI:20244) is a 3β-hydroxy steroid (CHEBI:36836) |
| 3β-hydroxy-4α-methyl-5α-cholest-7-ene-4β-carboxylic acid (CHEBI:20244) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| IUPAC Name |
|---|
| 3β-hydroxy-4α-methyl-5α-cholest-7-ene-4β-carboxylic acid |