EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O4 |
| Net Charge | 0 |
| Average Mass | 268.353 |
| Monoisotopic Mass | 268.16746 |
| SMILES | C[C@]12CCC[C@](C)(C(=O)O)[C@@H]1CC=C(CO)[C@@H]2CO |
| InChI | InChI=1S/C15H24O4/c1-14-6-3-7-15(2,13(18)19)12(14)5-4-10(8-16)11(14)9-17/h4,11-12,16-17H,3,5-9H2,1-2H3,(H,18,19)/t11-,12+,14+,15-/m0/s1 |
| InChIKey | JXXGSRMRZPQIQN-MXYBEHONSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Agaricus arvensis (ncbitaxon:34428) | - | PubMed (23421620) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11,12-dihydroxy-15-drimeneoic acid (CHEBI:202431) is a carboxylic acid (CHEBI:33575) |
| IUPAC Name |
|---|
| (1S,4aS,5R,8aR)-5,6-bis(hydroxymethyl)-1,4a-dimethyl-2,3,4,5,8,8a-hexahydronaphthalene-1-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440889 | ChemSpider |