EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18N2O6 |
| Net Charge | 0 |
| Average Mass | 310.306 |
| Monoisotopic Mass | 310.11649 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)Cc1ccc(O)c(C=O)c1)C(=O)O |
| InChI | InChI=1S/C14H18N2O6/c1-7(18)12(14(21)22)16-13(20)10(15)5-8-2-3-11(19)9(4-8)6-17/h2-4,6-7,10,12,18-19H,5,15H2,1H3,(H,16,20)(H,21,22)/t7-,10+,12+/m1/s1 |
| InChIKey | CLSAEXZTTQJZHA-VHRDEZTHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudoalteromonas tunicata (ncbitaxon:314281) | - | PubMed (20041686) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-formyl-L-tyrosinyl-L-threonine (CHEBI:202422) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,3R)-2-[[(2S)-2-amino-3-(3-ormyl-4-hydroxyphenyl)propanoyl]amino]-3-hydroxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 27024561 | ChemSpider |