EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H12NO6P |
| Net Charge | 0 |
| Average Mass | 213.126 |
| Monoisotopic Mass | 213.04022 |
| SMILES | CC(=O)N(O)C[C@@H](O)CP(=O)(O)O |
| InChI | InChI=1S/C5H12NO6P/c1-4(7)6(9)2-5(8)3-13(10,11)12/h5,8-9H,2-3H2,1H3,(H2,10,11,12)/t5-/m1/s1 |
| InChIKey | SMXUDUOWTDBXDT-RXMQYKEDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies (ncbitaxon:1931) | - | PubMed (7372547) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fr-33289 (CHEBI:202385) is a phosphonoacetic acid (CHEBI:15732) |
| Fr-33289 (CHEBI:202385) is conjugate acid of FR-33289(1−) (CHEBI:229210) |
| Incoming Relation(s) |
| FR-33289(1−) (CHEBI:229210) is conjugate base of Fr-33289 (CHEBI:202385) |
| IUPAC Name |
|---|
| [(2R)-3-[acetyl(hydroxy)amino]-2-hydroxypropyl]phosphonic acid |
| Manual Xrefs | Databases |
|---|---|
| 137221 | ChemSpider |