EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O12 |
| Net Charge | 0 |
| Average Mass | 478.406 |
| Monoisotopic Mass | 478.11113 |
| SMILES | COc1c(O)c(-c2c(O)c(OC)c(OC)c3c2OC(C)(O)C3=O)c2c(c1OC)C(=O)C(C)(O)O2 |
| InChI | InChI=1S/C22H22O12/c1-21(27)19(25)9-13(33-21)7(11(23)17(31-5)15(9)29-3)8-12(24)18(32-6)16(30-4)10-14(8)34-22(2,28)20(10)26/h23-24,27-28H,1-6H3 |
| InChIKey | GYLZUKZHWRRURG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Microsphaeropsis arundinis (ncbitaxon:413604) | - | PubMed (23294378) |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arundinone B (CHEBI:202372) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| 7-(2,6-dihydroxy-4,5-dimethoxy-2-methyl-3-oxo-1-benzouran-7-yl)-2,6-dihydroxy-4,5-dimethoxy-2-methyl-1-benzouran-3-one |
| Manual Xrefs | Databases |
|---|---|
| 29419125 | ChemSpider |