EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H39N3O6 |
| Net Charge | 0 |
| Average Mass | 477.602 |
| Monoisotopic Mass | 477.28389 |
| SMILES | CC[C@@H](C)[C@H](NC(C)=O)C(=O)N(C)[C@H](Cc1ccc(O)cc1)C(=O)N[C@@H](CC(C)C)C(=O)OC |
| InChI | InChI=1S/C25H39N3O6/c1-8-16(4)22(26-17(5)29)24(32)28(6)21(14-18-9-11-19(30)12-10-18)23(31)27-20(13-15(2)3)25(33)34-7/h9-12,15-16,20-22,30H,8,13-14H2,1-7H3,(H,26,29)(H,27,31)/t16-,20+,21-,22+/m1/s1 |
| InChIKey | USCBZDVDPQNLLA-ZJMJOCHXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Simplicillium (ncbitaxon:292631) | - | DOI (10.1016/j.tet.2016.04.032) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Simplicilliumtide E (CHEBI:202370) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| methyl (2S)-2-[[(2R)-2-[[(2S,3R)-2-acetamido-3-methylpentanoyl]-methylamino]-3-(4-hydroxyphenyl)propanoyl]amino]-4-methylpentanoate |
| Manual Xrefs | Databases |
|---|---|
| 58196800 | ChemSpider |