EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H34N6O13 |
| Net Charge | 0 |
| Average Mass | 626.576 |
| Monoisotopic Mass | 626.21839 |
| SMILES | COC1C(C(OC2OC(C(=O)NC3CCCC(C)NC3=O)=CC(O)C2O)C(N)=O)OC(n2ccc(=O)nc2=O)C1OC(N)=O |
| InChI | InChI=1S/C25H34N6O13/c1-9-4-3-5-10(20(36)28-9)29-21(37)12-8-11(32)14(34)23(41-12)43-17(19(26)35)16-15(40-2)18(44-24(27)38)22(42-16)31-7-6-13(33)30-25(31)39/h6-11,14-18,22-23,32,34H,3-5H2,1-2H3,(H2,26,35)(H2,27,38)(H,28,36)(H,29,37)(H,30,33,39) |
| InChIKey | DSKGVLLYPPLLJF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomycesspecies SANK 62799 (ncbitaxon:701528) | - | PubMed (15638324) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| A-503083 A (CHEBI:202361) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| [5-[2-amino-1-[[3,4-dihydroxy-6-[(7-methyl-2-oxoazepan-3-yl)carbamoyl]-3,4-dihydro-2H-pyran-2-yl]oxy]-2-oxoethyl]-2-(2,4-dioxopyrimidin-1-yl)-4-methoxyoxolan-3-yl] carbamate |
| Manual Xrefs | Databases |
|---|---|
| 8006346 | ChemSpider |