EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H39N3O5 |
| Net Charge | 0 |
| Average Mass | 425.570 |
| Monoisotopic Mass | 425.28897 |
| SMILES | CCCCC(C)C1CC(=O)N[C@@H](C(C)C)C(=O)N[C@@H](C)C(=O)N[C@H](C(C)C)C(=O)O1 |
| InChI | InChI=1S/C22H39N3O5/c1-8-9-10-14(6)16-11-17(26)24-18(12(2)3)21(28)23-15(7)20(27)25-19(13(4)5)22(29)30-16/h12-16,18-19H,8-11H2,1-7H3,(H,23,28)(H,24,26)(H,25,27)/t14?,15-,16?,18-,19+/m0/s1 |
| InChIKey | YVEIVEAWQYFHFP-KRELLBQZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Beauveria (ncbitaxon:5581) | - | PubMed (15032479) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Beauveriolide IV (CHEBI:202345) is a cyclodepsipeptide (CHEBI:35213) |
| IUPAC Name |
|---|
| (3R,6S,9S)-13-hexan-2-yl-6-methyl-3,9-di(propan-2-yl)-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| Manual Xrefs | Databases |
|---|---|
| 8378156 | ChemSpider |