EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16O4 |
| Net Charge | 0 |
| Average Mass | 224.256 |
| Monoisotopic Mass | 224.10486 |
| SMILES | CC(C)=CC[C@@H](CC1=CC(=O)OC1)C(=O)O |
| InChI | InChI=1S/C12H16O4/c1-8(2)3-4-10(12(14)15)5-9-6-11(13)16-7-9/h3,6,10H,4-5,7H2,1-2H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | XXPVXRYPOYQVHN-JTQLQIEISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Boreostereum vibrans (ncbitaxon:1826779) | - | PubMed (22296151) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Vibralactone J (CHEBI:202334) is a medium-chain fatty acid (CHEBI:59554) |
| IUPAC Name |
|---|
| 5-methyl-2-[(5-oxo-2H-uran-3-yl)methyl]hex-4-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78435609 | ChemSpider |