EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H60O8 |
| Net Charge | 0 |
| Average Mass | 596.846 |
| Monoisotopic Mass | 596.42882 |
| SMILES | C/C1=C/C[C@@H](O)[C@@H](C)[C@H](O)C[C@H](O)/C(C)=C\[C@@H](C)CCC[C@H](C)[C@@H]([C@H](C)CCCCC(O)CCCCC(=O)O)OC1=O |
| InChI | InChI=1S/C34H60O8/c1-22-12-11-14-24(3)33(23(2)13-7-8-15-28(35)16-9-10-17-32(39)40)42-34(41)25(4)18-19-29(36)27(6)31(38)21-30(37)26(5)20-22/h18,20,22-24,27-31,33,35-38H,7-17,19,21H2,1-6H3,(H,39,40)/b25-18-,26-20-/t22-,23+,24-,27+,28?,29+,30-,31+,33+/m0/s1 |
| InChIKey | VXRKSYNLMXQRIG-FKDUNVJISA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sorangium cellulosum (ncbitaxon:56) | - | DOI (10.1002/jlac.1995199505125) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sorangiolide B (CHEBI:202299) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (11R)-6-hydroxy-11-[(2R,3S,7S,8Z,10S,12R,13R,14R,16Z)-10,12,14-trihydroxy-3,7,9,13,17-pentamethyl-18-oxo-1-oxacyclooctadeca-8,16-dien-2-yl]dodecanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442543 | ChemSpider |