EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H17N3O5 |
| Net Charge | 0 |
| Average Mass | 367.361 |
| Monoisotopic Mass | 367.11682 |
| SMILES | CC(=O)NC1=CC(=O)C(N[C@@H](Cc2cnc3ccccc23)C(=O)O)=CC1=O |
| InChI | InChI=1S/C19H17N3O5/c1-10(23)21-14-7-18(25)15(8-17(14)24)22-16(19(26)27)6-11-9-20-13-5-3-2-4-12(11)13/h2-5,7-9,16,20,22H,6H2,1H3,(H,21,23)(H,26,27)/t16-/m0/s1 |
| InChIKey | BWDJZYRMJQSMFC-INIZCTEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces (ncbitaxon:1883) | - | PubMed (21952099) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Abenquine D (CHEBI:202292) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2S)-2-[(4-acetamido-3,6-dioxocyclohexa-1,4-dien-1-yl)amino]-3-(1H-indol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78440131 | ChemSpider |