EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O4 |
| Net Charge | 0 |
| Average Mass | 172.180 |
| Monoisotopic Mass | 172.07356 |
| SMILES | CC(=O)OCC/C(C)=C/C(=O)O |
| InChI | InChI=1S/C8H12O4/c1-6(5-8(10)11)3-4-12-7(2)9/h5H,3-4H2,1-2H3,(H,10,11)/b6-5+ |
| InChIKey | WRWUZZKIEIMUGX-AATRIKPKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsisspecies (ncbitaxon:36460) | - | DOI (10.1016/j.tetlet.2010.10.131) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pestalotiopin A (CHEBI:202196) is a methyl-branched fatty acid (CHEBI:62499) |
| IUPAC Name |
|---|
| (E)-5-acetyloxy-3-methylpent-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 27026282 | ChemSpider |