EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H5NO2S2 |
| Net Charge | 0 |
| Average Mass | 199.256 |
| Monoisotopic Mass | 198.97617 |
| SMILES | O=C(S)c1cccc(C(=O)S)n1 |
| InChI | InChI=1S/C7H5NO2S2/c9-6(11)4-2-1-3-5(8-4)7(10)12/h1-3H,(H,9,11)(H,10,12) |
| InChIKey | SSRIAMRLMUFTNV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonasspecies (ncbitaxon:306) | - | DOI (10.1016/s0040-4039(01)85634-3) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pyridine-2,6-dithiocarboxylic acid (CHEBI:202171) is a aromatic carboxylic acid (CHEBI:33859) |
| Pyridine-2,6-dithiocarboxylic acid (CHEBI:202171) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| IUPAC Name |
|---|
| pyridine-2,6-dicarbothioic S-acid |
| Manual Xrefs | Databases |
|---|---|
| 8389947 | ChemSpider |