EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H28N2O10 |
| Net Charge | 0 |
| Average Mass | 408.404 |
| Monoisotopic Mass | 408.17440 |
| SMILES | CC[C@H](C)[C@H](NCC1(O)OCC(O)C(O)C1O)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H28N2O10/c1-3-7(2)11(14(24)18-8(15(25)26)4-10(20)21)17-6-16(27)13(23)12(22)9(19)5-28-16/h7-9,11-13,17,19,22-23,27H,3-6H2,1-2H3,(H,18,24)(H,20,21)(H,25,26)/t7-,8-,9?,11-,12?,13?,16?/m0/s1 |
| InChIKey | BELGAWBTHZWTMH-CCOUJTDRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces albus (ncbitaxon:1888) | - | DOI (10.1002/jlac.199619960120) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(1-deoxyfructos-1-yl)-isoleucyl-aspartate (CHEBI:202167) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S)-2-[[(2S,3S)-3-methyl-2-[(2,3,4,5-tetrahydroxyoxan-2-yl)methylamino]pentanoyl]amino]butanedioic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445662 | ChemSpider |