EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19NO5 |
| Net Charge | 0 |
| Average Mass | 293.319 |
| Monoisotopic Mass | 293.12632 |
| SMILES | COC(=O)CCC(=O)[C@H](Cc1ccc(O)cc1)NC(C)=O |
| InChI | InChI=1S/C15H19NO5/c1-10(17)16-13(14(19)7-8-15(20)21-2)9-11-3-5-12(18)6-4-11/h3-6,13,18H,7-9H2,1-2H3,(H,16,17)/t13-/m0/s1 |
| InChIKey | AHJYJENDMNBMKK-ZDUSSCGKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Nigrospora (ncbitaxon:114230) | - | PubMed (22694214) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl 5-acetamido-6-(4-hydroxyphenyl)-4-oxohexanoate (CHEBI:202121) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| methyl 5-acetamido-6-(4-hydroxyphenyl)-4-oxohexanoate |
| Manual Xrefs | Databases |
|---|---|
| 78435605 | ChemSpider |