EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19NO3 |
| Net Charge | 0 |
| Average Mass | 285.343 |
| Monoisotopic Mass | 285.13649 |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c19-12-16(11-14-7-3-1-4-8-14)18-17(20)21-13-15-9-5-2-6-10-15/h1-10,16,19H,11-13H2,(H,18,20)/t16-/m0/s1 |
| InChIKey | WPOFMMJJCPZPAO-INIZCTEOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Fusarium sambucinum (ncbitaxon:5128) | - | DOI (10.1016/0040-4039(92)88083-h) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-carbobenzoxy-L-phenylalanilol (CHEBI:202107) is a amphetamines (CHEBI:35338) |
| IUPAC Name |
|---|
| benzyl N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]carbamate |
| Manual Xrefs | Databases |
|---|---|
| 745884 | ChemSpider |