EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H42O5 |
| Net Charge | 0 |
| Average Mass | 434.617 |
| Monoisotopic Mass | 434.30322 |
| SMILES | COC1(OC)CC[C@@]2(C)C(CC(=O)C3C2CC[C@@]2(C)C3CCC2[C@H](C)CCC(=O)O)C1 |
| InChI | InChI=1S/C26H42O5/c1-16(6-9-22(28)29)18-7-8-19-23-20(10-11-25(18,19)3)24(2)12-13-26(30-4,31-5)15-17(24)14-21(23)27/h16-20,23H,6-15H2,1-5H3,(H,28,29)/t16-,17?,18?,19?,20?,23?,24+,25-/m1/s1 |
| InChIKey | MNGASGFOKSKGQQ-MDRFGTDSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Psychrobacterspecies (ncbitaxon:56811) | - | PubMed (19557363) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-Dimethoxy-7-ketocholanic acid (CHEBI:201956) is a bile acid (CHEBI:3098) |
| IUPAC Name |
|---|
| (4R)-4-[(10S,13R)-3,3-dimethoxy-10,13-dimethyl-7-oxo-2,4,5,6,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78445500 | ChemSpider |