EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N5O9 |
| Net Charge | 0 |
| Average Mass | 479.446 |
| Monoisotopic Mass | 479.16523 |
| SMILES | CC(C(N)C(=O)NC(C(=O)O)C1OC(n2ccc(=O)nc2=O)C(O)C1O)C(O)c1ccccn1 |
| InChI | InChI=1S/C20H25N5O9/c1-8(13(27)9-4-2-3-6-22-9)11(21)17(30)24-12(19(31)32)16-14(28)15(29)18(34-16)25-7-5-10(26)23-20(25)33/h2-8,11-16,18,27-29H,21H2,1H3,(H,24,30)(H,31,32)(H,23,26,33) |
| InChIKey | HYBLVRJOBLCCCY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces tendae (ncbitaxon:1932) | - | PubMed (10470685) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nikkomycin Lz (CHEBI:201891) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-[(2-amino-4-hydroxy-3-methyl-4-pyridin-2-ylbutanoyl)amino]-2-[5-(2,4-dioxopyrimidin-1-yl)-3,4-dihydroxyoxolan-2-yl]acetic acid |
| Manual Xrefs | Databases |
|---|---|
| 78444780 | ChemSpider |