EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H8N2O2 |
| Net Charge | 0 |
| Average Mass | 236.230 |
| Monoisotopic Mass | 236.05858 |
| SMILES | O=c1cc(O)c2nccc3c4ccccc4n1c23 |
| InChI | InChI=1S/C14H8N2O2/c17-11-7-12(18)16-10-4-2-1-3-8(10)9-5-6-15-13(11)14(9)16/h1-7,17H |
| InChIKey | ITUDNKAMEIUZFU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-Hydroxycanthin-6-one (CHEBI:201855) is a alkaloid (CHEBI:22315) |
| 4-Hydroxycanthin-6-one (CHEBI:201855) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| 4-hydroxy-1,6-diazatetracyclo[7.6.1.05,16.010,15]hexadeca-3,5(16),6,8,10,12,14-heptaen-2-one |
| Manual Xrefs | Databases |
|---|---|
| 103846780 | ChemSpider |