EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H10O |
| Net Charge | 0 |
| Average Mass | 194.233 |
| Monoisotopic Mass | 194.07316 |
| SMILES | Oc1ccc2ccc3ccccc3c2c1 |
| InChI | InChI=1S/C14H10O/c15-12-8-7-11-6-5-10-3-1-2-4-13(10)14(11)9-12/h1-9,15H |
| InChIKey | NGPOABOEXMDQBT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-phenanthrol (CHEBI:20184) is a phenanthrol (CHEBI:25962) |
| IUPAC Name |
|---|
| phenanthren-3-ol |
| Synonyms | Source |
|---|---|
| 3-hydroxyphenanthrene | ChEBI |
| 3-phenanthrenol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| c0494 | UM-BBD |
| Registry Numbers | Sources |
|---|---|
| CAS:605-87-8 | UM-BBD |