EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7N5O2 |
| Net Charge | 0 |
| Average Mass | 193.166 |
| Monoisotopic Mass | 193.05997 |
| SMILES | Cn1c(=O)c2ncnnc2n(C)c1=O |
| InChI | InChI=1S/C7H7N5O2/c1-11-5-4(8-3-9-10-5)6(13)12(2)7(11)14/h3H,1-2H3 |
| InChIKey | RRTKVYSLIGQWCO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fervenulin (CHEBI:201828) is a 9,11,15-octadecatrienoic acid (CHEBI:38387) |
| IUPAC Name |
|---|
| 6,8-dimethylpyrimido[5,4-e][1,2,4]triazine-5,7-dione |
| Manual Xrefs | Databases |
|---|---|
| 218598 | ChemSpider |