EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H23N3O7S.2Na |
| Net Charge | 0 |
| Average Mass | 519.487 |
| Monoisotopic Mass | 519.10521 |
| SMILES | CC(O)C1C(=O)N2C(C(=O)[O-])=C(SC3CNC(C(=O)Nc4cccc(C(=O)[O-])c4)C3)C(C)C12.[Na+].[Na+] |
| InChI | InChI=1S/C22H25N3O7S.2Na/c1-9-16-15(10(2)26)20(28)25(16)17(22(31)32)18(9)33-13-7-14(23-8-13)19(27)24-12-5-3-4-11(6-12)21(29)30;;/h3-6,9-10,13-16,23,26H,7-8H2,1-2H3,(H,24,27)(H,29,30)(H,31,32);;/q;2*+1/p-2 |
| InChIKey | KMVRATCHVMUJHM-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ertapenem Disodium (CHEBI:201812) is a carbapenems (CHEBI:46633) |
| IUPAC Name |
|---|
| disodium;(4R,5S,6S)-3-[(3S,5S)-5-[(3-carboxylatophenyl)carbamoyl]pyrrolidin-3-yl]sulanyl-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 132759 | ChemSpider |