EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20F6N2O5 |
| Net Charge | 0 |
| Average Mass | 422.322 |
| Monoisotopic Mass | 422.12764 |
| SMILES | CC(CC(=O)OC(C)(C)C)NC(=O)C1=NOC(C(O)(C(F)(F)F)C(F)(F)F)C1 |
| InChI | InChI=1S/C15H20F6N2O5/c1-7(5-10(24)27-12(2,3)4)22-11(25)8-6-9(28-23-8)13(26,14(16,17)18)15(19,20)21/h7,9,26H,5-6H2,1-4H3,(H,22,25) |
| InChIKey | SBPVPWWNQIKSKL-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | EC 4.1.1.9 (malonyl-CoA decarboxylase) inhibitor Any EC 4.1.1.* (carboxy-lyase) inhibitor that interferes with the action of malonyl-CoA decarboxylase (EC 4.1.1.9). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| CBM-301940 (CHEBI:201746) has role EC 4.1.1.9 (malonyl-CoA decarboxylase) inhibitor (CHEBI:747693) |
| CBM-301940 (CHEBI:201746) is a tert-butyl ester (CHEBI:140402) |
| CBM-301940 (CHEBI:201746) is a isoxazoline (CHEBI:87553) |
| CBM-301940 (CHEBI:201746) is a organofluorine compound (CHEBI:37143) |
| CBM-301940 (CHEBI:201746) is a secondary carboxamide (CHEBI:140325) |
| CBM-301940 (CHEBI:201746) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| tert-butyl 3-{[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydro-1,2-oxazol-3-yl]carboxamido}butanoate |
| Synonyms | Source |
|---|---|
| CBM 301940 | ChEBI |
| CBM301940 | ChEBI |
| tert-butyl 3-(5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dihydroisoxazole-3-carboxamido)butanoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 8562931 | ChemSpider |
| Citations |
|---|