EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO5 |
| Net Charge | 0 |
| Average Mass | 281.308 |
| Monoisotopic Mass | 281.12632 |
| SMILES | COC(=O)[C@H](C)NC(=O)c1c(C)c(C)c(O)c(C)c1O |
| InChI | InChI=1S/C14H19NO5/c1-6-7(2)11(16)8(3)12(17)10(6)13(18)15-9(4)14(19)20-5/h9,16-17H,1-5H3,(H,15,18)/t9-/m0/s1 |
| InChIKey | HQWITITYACHYLX-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Umbelopsis vinacea (ncbitaxon:44442) | - | PubMed (10075797) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Mortivinacin C (CHEBI:201730) is a N-acylglycine (CHEBI:16180) |
| IUPAC Name |
|---|
| methyl (2S)-2-[(2,4-dihydroxy-3,5,6-trimethylbenzoyl)amino]propanoate |
| Manual Xrefs | Databases |
|---|---|
| 8978067 | ChemSpider |