EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H11NO2.HCl |
| Net Charge | 0 |
| Average Mass | 165.620 |
| Monoisotopic Mass | 165.05566 |
| SMILES | CC1([C@H](N)C(=O)O)CC1.Cl |
| InChI | InChI=1S/C6H11NO2.ClH/c1-6(2-3-6)4(7)5(8)9;/h4H,2-3,7H2,1H3,(H,8,9);1H/t4-;/m1./s1 |
| InChIKey | VQQHSQUJNCJSCW-PGMHMLKASA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-2-Amino-2-(1-methylcyclopropyl)acetic acid hydrochloride (CHEBI:201714) is a L-α-amino acid (CHEBI:15705) |
| IUPAC Name |
|---|
| (2S)-2-amino-2-(1-methylcyclopropyl)acetic acid;hydrochloride |
| Manual Xrefs | Databases |
|---|---|
| 29784388 | ChemSpider |