EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29ClO7 |
| Net Charge | 0 |
| Average Mass | 416.898 |
| Monoisotopic Mass | 416.16018 |
| SMILES | CCCCCC(O)CC1=C(C(Cl)OC)C(=O)[C@H]2O[C@@]2(C/C=C(\C)C(=O)O)[C@H]1O |
| InChI | InChI=1S/C20H29ClO7/c1-4-5-6-7-12(22)10-13-14(18(21)27-3)15(23)17-20(28-17,16(13)24)9-8-11(2)19(25)26/h8,12,16-18,22,24H,4-7,9-10H2,1-3H3,(H,25,26)/b11-8+/t12?,16-,17+,18?,20-/m0/s1 |
| InChIKey | LLXPVCOJUSFMCM-HIYIFQFDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pestalotiopsisspecies CR013 (ncbitaxon:1587512) | - | DOI (10.1016/j.phytol.2014.10.002) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-4-[(1S,2S,6S)-4-[chloro(methoxy)methyl]-2-hydroxy-3-(2-hydroxyheptyl)-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoic acid (CHEBI:201711) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| (E)-4-[(1S,2S,6S)-4-[chloro(methoxy)methyl]-2-hydroxy-3-(2-hydroxyheptyl)-5-oxo-7-oxabicyclo[4.1.0]hept-3-en-1-yl]-2-methylbut-2-enoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78442289 | ChemSpider |