EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H21ClN2O7.HCl |
| Net Charge | 0 |
| Average Mass | 497.331 |
| Monoisotopic Mass | 496.08041 |
| SMILES | Cc1c2c(c(O)c3c(O)ccc(Cl)c13)C(=O)C1(O)C(O)=C(C(N)=O)C(=O)C(N(C)C)C1C2.Cl |
| InChI | InChI=1S/C22H21ClN2O7.ClH/c1-7-8-6-9-16(25(2)3)18(28)15(21(24)31)20(30)22(9,32)19(29)13(8)17(27)14-11(26)5-4-10(23)12(7)14;/h4-5,9,16,26-27,30,32H,6H2,1-3H3,(H2,24,31);1H |
| InChIKey | ISGAAFMBTIWTEU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Epianhydrochlortetracycline hydrochloride (CHEBI:201671) is a tetracyclines (CHEBI:26895) |
| IUPAC Name |
|---|
| (4R,4aS,12aR)-7-chloro-4-(dimethylamino)-1,10,11,12a-tetrahydroxy-6-methyl-3,12-dioxo-4a,5-dihydro-4H-tetracene-2-carboxamide;hydrochloride |
| Manual Xrefs | Databases |
|---|---|
| 57563341 | ChemSpider |