EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H13N3O4 |
| Net Charge | 0 |
| Average Mass | 263.253 |
| Monoisotopic Mass | 263.09061 |
| SMILES | CN[C@@H](Cc1cnc2cccc([N+](=O)[O-])c12)C(=O)O |
| InChI | InChI=1S/C12H13N3O4/c1-13-9(12(16)17)5-7-6-14-8-3-2-4-10(11(7)8)15(18)19/h2-4,6,9,13-14H,5H2,1H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | QXDTZLBLXHZFKC-VIFPVBQESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces scabiei (ncbitaxon:1930) | - | DOI (10.1016/0031-9422(95)00256-7) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-methyl-4-nitrotryptophan (CHEBI:201649) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| (2S)-2-(methylamino)-3-(4-nitro-1H-indol-3-yl)propanoic acid |