EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C52H70N2O10 |
| Net Charge | 0 |
| Average Mass | 883.136 |
| Monoisotopic Mass | 882.50305 |
| SMILES | CC(C)=CCCC(C)=CCCC1(C)Oc2c(c(O)cc3c2CN(CCCCC(C(=O)O)N2Cc4c(cc(O)c5c4OC(C)(CCC=C(C)CCC=C(C)C)C(O)C5)C2=O)C3=O)CC1O |
| InChI | InChI=1S/C52H70N2O10/c1-31(2)15-11-17-33(5)19-13-22-51(7)44(57)27-37-42(55)25-35-39(46(37)63-51)29-53(48(35)59)24-10-9-21-41(50(61)62)54-30-40-36(49(54)60)26-43(56)38-28-45(58)52(8,64-47(38)40)23-14-20-34(6)18-12-16-32(3)4/h15-16,19-20,25-26,41,44-45,55-58H,9-14,17-18,21-24,27-30H2,1-8H3,(H,61,62) |
| InChIKey | SJMBRLPDWBJVRZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Stachybotrys (ncbitaxon:74721) | - | PubMed (10819294) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| SMTP-8 (CHEBI:201645) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| 2,6-bis[2-(4,8-dimethylnona-3,7-dienyl)-3,5-dihydroxy-2-methyl-7-oxo-4,9-dihydro-3H-pyrano[2,3-e]isoindol-8-yl]hexanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 78443985 | ChemSpider |