EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9NO5P.Na |
| Net Charge | 0 |
| Average Mass | 205.082 |
| Monoisotopic Mass | 205.01160 |
| SMILES | O=CN(O)CCC[P@](=O)([O-])O.[Na+] |
| InChI | InChI=1S/C4H10NO5P.Na/c6-4-5(7)2-1-3-11(8,9)10;/h4,7H,1-3H2,(H2,8,9,10);/q;+1/p-1 |
| InChIKey | ZZPUYRHMTGOTEU-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fosmidomycin sodium salt (CHEBI:201600) is a phosphonoacetic acid (CHEBI:15732) |
| IUPAC Name |
|---|
| sodium;3-[ormyl(hydroxy)amino]propyl-hydroxyphosphinate |
| Manual Xrefs | Databases |
|---|---|
| 150179 | ChemSpider |