EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:201571 - gentamicin C2a
| Formula | C20H41N5O7 |
| Net Charge | 0 |
| Average Mass | 463.576 |
| Monoisotopic Mass | 463.30060 |
| SMILES | CN[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H]([C@H](C)N)CC[C@H]3N)[C@@H](N)C[C@H]2N)OC[C@]1(C)O |
| InChI | InChI=1S/C20H41N5O7/c1-8(21)12-5-4-9(22)18(30-12)31-15-10(23)6-11(24)16(13(15)26)32-19-14(27)17(25-3)20(2,28)7-29-19/h8-19,25-28H,4-7,21-24H2,1-3H3/t8-,9+,10-,11+,12-,13-,14+,15+,16-,17+,18+,19+,20-/m0/s1 |
| InChIKey | XUFIWSHGXVLULG-BSBKYKEKSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gentamicin C2a (CHEBI:201571) is a gentamycin C (CHEBI:28417) |
| gentamicin C2a (CHEBI:201571) is conjugate base of gentamycin C2a (CHEBI:231950) |
| Incoming Relation(s) |
| gentamycin C2a (CHEBI:231950) is conjugate acid of gentamicin C2a (CHEBI:201571) |
| IUPAC Name |
|---|
| (1R,2S,3S,4R,6S)-4,6-diamino-3-{[3-deoxy-4-C-methyl-3-(methylamino)-β-L-arabinopyranosyl]oxy}-2-hydroxycyclohexyl 2,6-diamino-2,3,4,6,7-pentadeoxy-β-L-lyxo-heptopyranoside |