EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H41N7O10 |
| Net Charge | 0 |
| Average Mass | 623.664 |
| Monoisotopic Mass | 623.29149 |
| SMILES | CNC(CCCN(O)C(=O)CCNC(=O)[C@H](C)NC(=O)[C@@H](CO)NC(=O)c1ccccc1O)C(=O)N[C@H]1CCCN(O)C1=O |
| InChI | InChI=1S/C27H41N7O10/c1-16(30-26(41)20(15-35)32-24(39)17-7-3-4-10-21(17)36)23(38)29-12-11-22(37)33(43)13-5-8-18(28-2)25(40)31-19-9-6-14-34(44)27(19)42/h3-4,7,10,16,18-20,28,35-36,43-44H,5-6,8-9,11-15H2,1-2H3,(H,29,38)(H,30,41)(H,31,40)(H,32,39)/t16-,18?,19-,20+/m0/s1 |
| InChIKey | MOMGVKXQWKFOCF-OHSMVPPVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinomadura madurae (ncbitaxon:1993) | - | PubMed (15112961) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Madurastatin A2 (CHEBI:201562) is a peptide (CHEBI:16670) |
| IUPAC Name |
|---|
| 2-hydroxy-N-[(2R)-3-hydroxy-1-[[(2S)-1-[[3-[hydroxy-[5-[[(3S)-1-hydroxy-2-oxopiperidin-3-yl]amino]-4-(methylamino)-5-oxopentyl]amino]-3-oxopropyl]amino]-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]benzamide |
| Manual Xrefs | Databases |
|---|---|
| 78436758 | ChemSpider |