EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H8S2 |
| Net Charge | 0 |
| Average Mass | 216.330 |
| Monoisotopic Mass | 216.00674 |
| SMILES | C=CC#Cc1ccc(-c2cccs2)s1 |
| InChI | InChI=1S/C12H8S2/c1-2-3-5-10-7-8-12(14-10)11-6-4-9-13-11/h2,4,6-9H,1H2 |
| InChIKey | GWAIEOFEEWQORO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-(3-buten-1-ynyl)-2,2'-bithiophene (CHEBI:2015) has role plant metabolite (CHEBI:76924) |
| 5-(3-buten-1-ynyl)-2,2'-bithiophene (CHEBI:2015) is a 2,2'-bithiophenes (CHEBI:19281) |
| 5-(3-buten-1-ynyl)-2,2'-bithiophene (CHEBI:2015) is a enyne (CHEBI:59831) |
| IUPAC Name |
|---|
| 5-but-3-en-1-yn-1-yl-2,2'-bithiophene |
| Synonyms | Source |
|---|---|
| 5-(3-Buten-1-ynyl)-2,2'-bithienyl | KEGG COMPOUND |
| 5-(3-Buten-1-ynyl)-2,2'-bithiophene | KEGG COMPOUND |