EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O2 |
| Net Charge | 0 |
| Average Mass | 262.353 |
| Monoisotopic Mass | 262.16813 |
| SMILES | O=C1C=CCC2C3CCC[N+]4([O-])CCCC(CN12)C34 |
| InChI | InChI=1S/C15H22N2O2/c18-14-7-1-6-13-12-5-3-9-17(19)8-2-4-11(15(12)17)10-16(13)14/h1,7,11-13,15H,2-6,8-10H2 |
| InChIKey | QMGGMESMCJCABO-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxysophocarpine (CHEBI:201467) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (1R,2R,9S,13R,17S)-13-oxido-7-aza-13-azoniatetracyclo[7.7.1.02,7.013,17]heptadec-4-en-6-one |
| Manual Xrefs | Databases |
|---|---|
| 29365023 | ChemSpider |