EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C3H5O4P.2Na |
| Net Charge | 0 |
| Average Mass | 182.023 |
| Monoisotopic Mass | 181.97208 |
| SMILES | CC1OC1P(=O)([O-])[O-].[Na+].[Na+] |
| InChI | InChI=1S/C3H7O4P.2Na/c1-2-3(7-2)8(4,5)6;;/h2-3H,1H3,(H2,4,5,6);;/q;2*+1/p-2 |
| InChIKey | QZIQJIKUVJMTDG-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. EC 2.7.7.7 (DNA-directed DNA polymerase) inhibitor A DNA polymerase inhibitor that interferes with the action of a DNA-directed DNA polymerase (EC 2.7.7.7). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Fosfomycin sodium (CHEBI:201404) is a phosphonoacetic acid (CHEBI:15732) |
| IUPAC Name |
|---|
| disodium;[(2R,3S)-3-methyloxiran-2-yl]-dioxido-oxo-lambda5-phosphane |