EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:20140 - 3-methylquinoline
| Formula | C10H9N |
| Net Charge | 0 |
| Average Mass | 143.189 |
| Monoisotopic Mass | 143.07350 |
| SMILES | Cc1cnc2ccccc2c1 |
| InChI | InChI=1S/C10H9N/c1-8-6-9-4-2-3-5-10(9)11-7-8/h2-7H,1H3 |
| InChIKey | DTBDAFLSBDGPEA-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-methylquinoline (CHEBI:20140) has role xenobiotic (CHEBI:35703) |
| 3-methylquinoline (CHEBI:20140) is a methylquinoline (CHEBI:48982) |
| IUPAC Name |
|---|
| 3-methylquinoline |
| Synonym | Source |
|---|---|
| 3-Methyl-1-benzazine | UM-BBD |
| UniProt Name | Source |
|---|---|
| 3-methylquinoline | UniProt |