EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O4 |
| Net Charge | 0 |
| Average Mass | 414.586 |
| Monoisotopic Mass | 414.27701 |
| SMILES | [H][C@@]1(CC/C(C)=C/CC/C(C)=C/Cc2c(O)cc(C)oc2=O)C(=C)CC[C@H](O)C1(C)C |
| InChI | InChI=1S/C26H38O4/c1-17(10-13-21-23(27)16-20(4)30-25(21)29)8-7-9-18(2)11-14-22-19(3)12-15-24(28)26(22,5)6/h9-10,16,22,24,27-28H,3,7-8,11-15H2,1-2,4-6H3/b17-10+,18-9+/t22-,24+/m1/s1 |
| InChIKey | YFZBONHCMBXFDD-JVRYRRRMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fischeri (ncbitaxon:36630) | - | PubMed (25586023) | Species also known as Neosartorya fischeri. Strain: FO-5897 |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.1.6 (fumarate reductase (NADH)) inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of fumarate reductase (NADH) (EC 1.3.1.6). Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sartorypyrone D (CHEBI:201384) has role Aspergillus metabolite (CHEBI:76956) |
| sartorypyrone D (CHEBI:201384) has role antibacterial agent (CHEBI:33282) |
| sartorypyrone D (CHEBI:201384) has role EC 1.3.1.6 (fumarate reductase (NADH)) inhibitor (CHEBI:231760) |
| sartorypyrone D (CHEBI:201384) is a 2-pyranones (CHEBI:75885) |
| sartorypyrone D (CHEBI:201384) is a heteroaryl hydroxy compound (CHEBI:74818) |
| sartorypyrone D (CHEBI:201384) is a meroterpenoid (CHEBI:64419) |
| sartorypyrone D (CHEBI:201384) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 4-hydroxy-3-{(2E,6E)-9-[(1R,3S)-3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]-3,7-dimethylnona-2,6-dien-1-yl}-6-methyl-2H-pyran-2-one |
| Synonym | Source |
|---|---|
| 4-hydroxy-3-[(2E,6E)-9-[(1R,3S)-3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]-3,7-dimethylnona-2,6-dienyl]-6-methylpyran-2-one | ChEBI |
| UniProt Name | Source |
|---|---|
| sartorypyrone D | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 109107930 | ChemSpider |
| Citations |
|---|