EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H38O4 |
| Net Charge | 0 |
| Average Mass | 414.586 |
| Monoisotopic Mass | 414.27701 |
| SMILES | [H][C@@]1(CC/C(C)=C/CC/C(C)=C/Cc2c(O)cc(C)oc2=O)C(=C)CC[C@H](O)C1(C)C |
| InChI | InChI=1S/C26H38O4/c1-17(10-13-21-23(27)16-20(4)30-25(21)29)8-7-9-18(2)11-14-22-19(3)12-15-24(28)26(22,5)6/h9-10,16,22,24,27-28H,3,7-8,11-15H2,1-2,4-6H3/b17-10+,18-9+/t22-,24+/m1/s1 |
| InChIKey | YFZBONHCMBXFDD-JVRYRRRMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Aspergillus fischeri (ncbitaxon:36630) | - | PubMed (25586023) | Species also known as Neosartorya fischeri. Strain: FO-5897 |
| Roles Classification |
|---|
| Biological Roles: | EC 1.3.1.6 (fumarate reductase (NADH)) inhibitor An EC 1.3.1.* (oxidoreductase acting on CH-CH group of donor, NAD+ or NADP+ as acceptor) inhibitor that interferes with the action of fumarate reductase (NADH) (EC 1.3.1.6). antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. Aspergillus metabolite Any fungal metabolite produced during a metabolic reaction in the mould, Aspergillus . metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sartorypyrone D (CHEBI:201384) has role Aspergillus metabolite (CHEBI:76956) |
| sartorypyrone D (CHEBI:201384) has role antibacterial agent (CHEBI:33282) |
| sartorypyrone D (CHEBI:201384) has role EC 1.3.1.6 (fumarate reductase (NADH)) inhibitor (CHEBI:231760) |
| sartorypyrone D (CHEBI:201384) is a 2-pyranones (CHEBI:75885) |
| sartorypyrone D (CHEBI:201384) is a heteroaryl hydroxy compound (CHEBI:74818) |
| sartorypyrone D (CHEBI:201384) is a meroterpenoid (CHEBI:64419) |
| sartorypyrone D (CHEBI:201384) is a olefinic compound (CHEBI:78840) |
| IUPAC Name |
|---|
| 4-hydroxy-3-{(2E,6E)-9-[(1R,3S)-3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]-3,7-dimethylnona-2,6-dien-1-yl}-6-methyl-2H-pyran-2-one |
| Synonym | Source |
|---|---|
| 4-hydroxy-3-[(2E,6E)-9-[(1R,3S)-3-hydroxy-2,2-dimethyl-6-methylidenecyclohexyl]-3,7-dimethylnona-2,6-dienyl]-6-methylpyran-2-one | ChEBI |
| UniProt Name | Source |
|---|---|
| sartorypyrone D | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 109107930 | ChemSpider |
| Citations |
|---|