EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H32O7 |
| Net Charge | 0 |
| Average Mass | 456.535 |
| Monoisotopic Mass | 456.21480 |
| SMILES | C=C1[C@@]2(C)C[C@@H]3C(C)=C4CC(=O)OC(C)(C)C4=CC[C@]3(C)[C@]1(C(=O)OC)[C@@](O)(C(C)=O)C2=O |
| InChI | InChI=1S/C26H32O7/c1-13-16-11-19(28)33-22(4,5)17(16)9-10-24(7)18(13)12-23(6)14(2)25(24,21(30)32-8)26(31,15(3)27)20(23)29/h9,18,31H,2,10-12H2,1,3-8H3/t18-,23-,24+,25+,26-/m1/s1 |
| InChIKey | ILLYYPDUAUMGTD-CUWBUZBVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Talaromyces purpureogenus (ncbitaxon:1266744) | - | PubMed (24684453) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Dhilirolide F (CHEBI:201368) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| methyl (1R,2S,12R,14R,16R)-16-acetyl-16-hydroxy-2,6,6,11,14-pentamethyl-17-methylidene-8,15-dioxo-7-oxatetracyclo[12.2.1.02,12.05,10]heptadeca-4,10-diene-1-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| 78440108 | ChemSpider |