EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H27NO6 |
| Net Charge | 0 |
| Average Mass | 365.426 |
| Monoisotopic Mass | 365.18384 |
| SMILES | CCCC=CC=CC(O)=C1C(=O)[C@@H](CC(O)(C(=O)O)C(C)C)N(C)C1=O |
| InChI | InChI=1S/C19H27NO6/c1-5-6-7-8-9-10-14(21)15-16(22)13(20(4)17(15)23)11-19(26,12(2)3)18(24)25/h7-10,12-13,21,26H,5-6,11H2,1-4H3,(H,24,25)/t13-,19?/m1/s1 |
| InChIKey | FQSWTHMMNDRFAI-BSOCMFCZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trichodermaspecies (ncbitaxon:1715253) | - | PubMed (25006784) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isoharzianic acid (CHEBI:201345) is a heterocyclic fatty acid (CHEBI:48847) |
| IUPAC Name |
|---|
| 2-hydroxy-2-[[(2R)-4-(1-hydroxyocta-2,4-dienylidene)-1-methyl-3,5-dioxopyrrolidin-2-yl]methyl]-3-methylbutanoic acid |